C11H8F5O8S- — CID 58445683
1,1,3,3,3-pentafluoro-2-(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carbonyl)oxypropane-1-sulfonate (PubChem CID 58445683) has the molecular formula C11H8F5O8S- and a molecular weight of 395.23 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carbonyl)oxypropane-1-sulfonate.
| Compound Name | 1,1,3,3,3-pentafluoro-2-(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carbonyl)oxypropane-1-sulfonate |
|---|---|
| PubChem CID | 58445683 |
| Molecular Formula | C11H8F5O8S- |
| Molecular Weight | 395.23 g/mol |
| Exact Mass | 394.99 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carbonyl)oxypropane-1-sulfonate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)S(=O)(=O)[O-])C1C2CC3OC(=O)C1C3O2 |
| InChI | InChI=1S/C11H9F5O8S/c12-10(13,14)9(11(15,16)25(19,20)21)24-7(17)4-2-1-3-6(22-2)5(4)8(18)23-3/h2-6,9H,1H2,(H,19,20,21)/p-1 |
| InChIKey | YDVRISKAVCXYMT-UHFFFAOYSA-M |
| XLogP | -0.07 |
| TPSA | 119.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.23 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|