C20H16ClFN2O — CID 58447770
1-(6-chloro-5-methyl-3-pyridinyl)-3-[5-(3-fluorophenyl)-2-pyridinyl]propan-2-one (PubChem CID 58447770) has the molecular formula C20H16ClFN2O and a molecular weight of 354.81 g/mol. Its IUPAC name is 1-(6-chloro-5-methyl-3-pyridinyl)-3-[5-(3-fluorophenyl)-2-pyridinyl]propan-2-one.
| Compound Name | 1-(6-chloro-5-methyl-3-pyridinyl)-3-[5-(3-fluorophenyl)-2-pyridinyl]propan-2-one |
|---|---|
| PubChem CID | 58447770 |
| Molecular Formula | C20H16ClFN2O |
| Molecular Weight | 354.81 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 1-(6-chloro-5-methyl-3-pyridinyl)-3-[5-(3-fluorophenyl)-2-pyridinyl]propan-2-one |
| SMILES | Cc1cc(CC(=O)Cc2ccc(-c3cccc(F)c3)cn2)cnc1Cl |
| InChI | InChI=1S/C20H16ClFN2O/c1-13-7-14(11-24-20(13)21)8-19(25)10-18-6-5-16(12-23-18)15-3-2-4-17(22)9-15/h2-7,9,11-12H,8,10H2,1H3 |
| InChIKey | CECQLKXWLGNQPQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.81 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|