C9H10N2 — CID 58449453
2,6-dimethyl-7H-cyclopenta[d]pyrimidine (PubChem CID 58449453) has the molecular formula C9H10N2 and a molecular weight of 146.19 g/mol. Its IUPAC name is 2,6-dimethyl-7H-cyclopenta[d]pyrimidine.
| Compound Name | 2,6-dimethyl-7H-cyclopenta[d]pyrimidine |
|---|---|
| PubChem CID | 58449453 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 2,6-dimethyl-7H-cyclopenta[d]pyrimidine |
| SMILES | CC1=Cc2cnc(C)nc2C1 |
| InChI | InChI=1S/C9H10N2/c1-6-3-8-5-10-7(2)11-9(8)4-6/h3,5H,4H2,1-2H3 |
| InChIKey | HLCUJUULWJZJMP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |