C19H37N — CID 58449982
1-tert-butyl-3,4-di(propan-2-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline (PubChem CID 58449982) has the molecular formula C19H37N and a molecular weight of 279.51 g/mol. Its IUPAC name is 1-tert-butyl-3,4-di(propan-2-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline.
| Compound Name | 1-tert-butyl-3,4-di(propan-2-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
|---|---|
| PubChem CID | 58449982 |
| Molecular Formula | C19H37N |
| Molecular Weight | 279.51 g/mol |
| Exact Mass | 279.29 |
| IUPAC Name | 1-tert-butyl-3,4-di(propan-2-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
| SMILES | CC(C)C1CN(C(C)(C)C)C2CCCCC2C1C(C)C |
| InChI | InChI=1S/C19H37N/c1-13(2)16-12-20(19(5,6)7)17-11-9-8-10-15(17)18(16)14(3)4/h13-18H,8-12H2,1-7H3 |
| InChIKey | ZQSKIPIJBNHJNY-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.51 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |