About 6-tert-butyl-8,9-di(propan-2-yl)-6-azabicyclo[3.2.2]nonane
6-tert-butyl-8,9-di(propan-2-yl)-6-azabicyclo[3.2.2]nonane (PubChem CID 58450094) has the molecular formula C18H35N
and a molecular weight of 265.48 g/mol. Its IUPAC name is 6-tert-butyl-8,9-di(propan-2-yl)-6-azabicyclo[3.2.2]nonane.
Molecular Properties
| Compound Name | 6-tert-butyl-8,9-di(propan-2-yl)-6-azabicyclo[3.2.2]nonane |
| PubChem CID | 58450094 |
| Molecular Formula | C18H35N |
| Molecular Weight | 265.48 g/mol |
| Exact Mass | 265.28 |
| IUPAC Name | 6-tert-butyl-8,9-di(propan-2-yl)-6-azabicyclo[3.2.2]nonane |
| SMILES | CC(C)C1C2CCCC(C1C(C)C)N(C(C)(C)C)C2 |
| InChI | InChI=1S/C18H35N/c1-12(2)16-14-9-8-10-15(17(16)13(3)4)19(11-14)18(5,6)7/h12-17H,8-11H2,1-7H3 |
| InChIKey | XKFJYMBQYYAKCT-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-tert-butyl-8,9-di(propan-2-yl)-6-azabicyclo[3.2.2]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-8,9-di(propan-2-yl)-6-azabicyclo[3.2.2]nonane?
The IUPAC name of 6-tert-butyl-8,9-di(propan-2-yl)-6-azabicyclo[3.2.2]nonane (CID 58450094) is 6-tert-butyl-8,9-di(propan-2-yl)-6-azabicyclo[3.2.2]nonane.
What is the SMILES notation for 6-tert-butyl-8,9-di(propan-2-yl)-6-azabicyclo[3.2.2]nonane?
The canonical SMILES for 6-tert-butyl-8,9-di(propan-2-yl)-6-azabicyclo[3.2.2]nonane is CC(C)C1C2CCCC(C1C(C)C)N(C(C)(C)C)C2.
What is the InChIKey of 6-tert-butyl-8,9-di(propan-2-yl)-6-azabicyclo[3.2.2]nonane?
The InChIKey is XKFJYMBQYYAKCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H35N/c1-12(2)16-14-9-8-10-15(17(16)13(3)4)19(11-14)18(5,6)7/h12-17H,8-11H2,1-7H3.
What are the key properties of 6-tert-butyl-8,9-di(propan-2-yl)-6-azabicyclo[3.2.2]nonane?
6-tert-butyl-8,9-di(propan-2-yl)-6-azabicyclo[3.2.2]nonane has a molecular weight of 265.48 g/mol, XLogP of 4.81, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-8,9-di(propan-2-yl)-6-azabicyclo[3.2.2]nonane is sourced from PubChem (CID 58450094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).