C12H14F3NO — CID 58450215
CID 58450215 (PubChem CID 58450215) has the molecular formula C12H14F3NO and a molecular weight of 245.24 g/mol.
| Compound Name | CID 58450215 |
|---|---|
| PubChem CID | 58450215 |
| Molecular Formula | C12H14F3NO |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | — |
| SMILES | [CH]OC(c1ccc(CN(C)C)cc1)C(F)(F)F |
| InChI | InChI=1S/C12H14F3NO/c1-16(2)8-9-4-6-10(7-5-9)11(17-3)12(13,14)15/h3-7,11H,8H2,1-2H3 |
| InChIKey | ZTIQGPWTLQSRCW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |