C22H24ClNO3S — CID 58452463
6-[(E)-1-[3-chloro-4-(3-hydroxypropylsulfanyl)phenyl]-2-[(1S)-3-oxocyclopentyl]ethenyl]-3-methyl-1H-pyridin-2-one (PubChem CID 58452463) has the molecular formula C22H24ClNO3S and a molecular weight of 417.96 g/mol. Its IUPAC name is 6-[(E)-1-[3-chloro-4-(3-hydroxypropylsulfanyl)phenyl]-2-[(1S)-3-oxocyclopentyl]ethenyl]-3-methyl-1H-pyridin-2-one.
| Compound Name | 6-[(E)-1-[3-chloro-4-(3-hydroxypropylsulfanyl)phenyl]-2-[(1S)-3-oxocyclopentyl]ethenyl]-3-methyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 58452463 |
| Molecular Formula | C22H24ClNO3S |
| Molecular Weight | 417.96 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 6-[(E)-1-[3-chloro-4-(3-hydroxypropylsulfanyl)phenyl]-2-[(1S)-3-oxocyclopentyl]ethenyl]-3-methyl-1H-pyridin-2-one |
| SMILES | Cc1ccc(/C(=C/[C@H]2CCC(=O)C2)c2ccc(SCCCO)c(Cl)c2)[nH]c1=O |
| InChI | InChI=1S/C22H24ClNO3S/c1-14-3-7-20(24-22(14)27)18(12-15-4-6-17(26)11-15)16-5-8-21(19(23)13-16)28-10-2-9-25/h3,5,7-8,12-13,15,25H,2,4,6,9-11H2,1H3,(H,24,27)/b18-12+/t15-/m0/s1 |
| InChIKey | NNUZIUHBCFCZHA-BRFSQIRFSA-N |
| XLogP | 4.61 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.96 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|