C22H24ClNO3 — CID 67397905
6-[1-(3-chloro-4-ethoxyphenyl)-2-[(1S)-3-oxocyclopentyl]ethenyl]-3-ethyl-1H-pyridin-2-one (PubChem CID 67397905) has the molecular formula C22H24ClNO3 and a molecular weight of 385.89 g/mol. Its IUPAC name is 6-[1-(3-chloro-4-ethoxyphenyl)-2-[(1S)-3-oxocyclopentyl]ethenyl]-3-ethyl-1H-pyridin-2-one.
| Compound Name | 6-[1-(3-chloro-4-ethoxyphenyl)-2-[(1S)-3-oxocyclopentyl]ethenyl]-3-ethyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 67397905 |
| Molecular Formula | C22H24ClNO3 |
| Molecular Weight | 385.89 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 6-[1-(3-chloro-4-ethoxyphenyl)-2-[(1S)-3-oxocyclopentyl]ethenyl]-3-ethyl-1H-pyridin-2-one |
| SMILES | CCOc1ccc(C(=C[C@H]2CCC(=O)C2)c2ccc(CC)c(=O)[nH]2)cc1Cl |
| InChI | InChI=1S/C22H24ClNO3/c1-3-15-6-9-20(24-22(15)26)18(12-14-5-8-17(25)11-14)16-7-10-21(27-4-2)19(23)13-16/h6-7,9-10,12-14H,3-5,8,11H2,1-2H3,(H,24,26)/t14-/m0/s1 |
| InChIKey | FDSKPWLPGUVSQL-AWEZNQCLSA-N |
| XLogP | 4.79 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.89 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |