C26H33ClN2O2 — CID 58452471
6-[(E)-1-[3-chloro-4-[3-(ethylamino)propoxy]phenyl]-2-cyclopentylethenyl]-3-cyclopropyl-1H-pyridin-2-one (PubChem CID 58452471) has the molecular formula C26H33ClN2O2 and a molecular weight of 441.02 g/mol. Its IUPAC name is 6-[(E)-1-[3-chloro-4-[3-(ethylamino)propoxy]phenyl]-2-cyclopentylethenyl]-3-cyclopropyl-1H-pyridin-2-one.
| Compound Name | 6-[(E)-1-[3-chloro-4-[3-(ethylamino)propoxy]phenyl]-2-cyclopentylethenyl]-3-cyclopropyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 58452471 |
| Molecular Formula | C26H33ClN2O2 |
| Molecular Weight | 441.02 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 6-[(E)-1-[3-chloro-4-[3-(ethylamino)propoxy]phenyl]-2-cyclopentylethenyl]-3-cyclopropyl-1H-pyridin-2-one |
| SMILES | CCNCCCOc1ccc(/C(=C\C2CCCC2)c2ccc(C3CC3)c(=O)[nH]2)cc1Cl |
| InChI | InChI=1S/C26H33ClN2O2/c1-2-28-14-5-15-31-25-13-10-20(17-23(25)27)22(16-18-6-3-4-7-18)24-12-11-21(19-8-9-19)26(30)29-24/h10-13,16-19,28H,2-9,14-15H2,1H3,(H,29,30)/b22-16+ |
| InChIKey | AKXNJGWCPDBQAY-CJLVFECKSA-N |
| XLogP | 5.91 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.02 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|