C22H28ClNO3Si — CID 58452780
[4-[tert-butyl(dimethyl)silyl]oxy-3-chlorophenyl]-(5-cyclopropyl-6-methoxy-2-pyridinyl)methanone (PubChem CID 58452780) has the molecular formula C22H28ClNO3Si and a molecular weight of 418.01 g/mol. Its IUPAC name is [4-[tert-butyl(dimethyl)silyl]oxy-3-chlorophenyl]-(5-cyclopropyl-6-methoxy-2-pyridinyl)methanone.
| Compound Name | [4-[tert-butyl(dimethyl)silyl]oxy-3-chlorophenyl]-(5-cyclopropyl-6-methoxy-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 58452780 |
| Molecular Formula | C22H28ClNO3Si |
| Molecular Weight | 418.01 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | [4-[tert-butyl(dimethyl)silyl]oxy-3-chlorophenyl]-(5-cyclopropyl-6-methoxy-2-pyridinyl)methanone |
| SMILES | COc1nc(C(=O)c2ccc(O[Si](C)(C)C(C)(C)C)c(Cl)c2)ccc1C1CC1 |
| InChI | InChI=1S/C22H28ClNO3Si/c1-22(2,3)28(5,6)27-19-12-9-15(13-17(19)23)20(25)18-11-10-16(14-7-8-14)21(24-18)26-4/h9-14H,7-8H2,1-6H3 |
| InChIKey | DCFCASMUYGTZSF-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.01 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|