C19H23Cl2NO3Si — CID 67398382
[4-[tert-butyl(dimethyl)silyl]oxy-3-chlorophenyl]-(5-chloro-6-methoxy-2-pyridinyl)methanone (PubChem CID 67398382) has the molecular formula C19H23Cl2NO3Si and a molecular weight of 412.39 g/mol. Its IUPAC name is [4-[tert-butyl(dimethyl)silyl]oxy-3-chlorophenyl]-(5-chloro-6-methoxy-2-pyridinyl)methanone.
| Compound Name | [4-[tert-butyl(dimethyl)silyl]oxy-3-chlorophenyl]-(5-chloro-6-methoxy-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 67398382 |
| Molecular Formula | C19H23Cl2NO3Si |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | [4-[tert-butyl(dimethyl)silyl]oxy-3-chlorophenyl]-(5-chloro-6-methoxy-2-pyridinyl)methanone |
| SMILES | COc1nc(C(=O)c2ccc(O[Si](C)(C)C(C)(C)C)c(Cl)c2)ccc1Cl |
| InChI | InChI=1S/C19H23Cl2NO3Si/c1-19(2,3)26(5,6)25-16-10-7-12(11-14(16)21)17(23)15-9-8-13(20)18(22-15)24-4/h7-11H,1-6H3 |
| InChIKey | VRXGFMCDNLTKGE-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|