C32H36N4O2S — CID 58456833
6-[1-(4-methylphenyl)piperidin-4-yl]oxy-N-[1-(pyridin-4-ylmethyl)piperidin-4-yl]-1-benzothiophene-2-carboxamide (PubChem CID 58456833) has the molecular formula C32H36N4O2S and a molecular weight of 540.73 g/mol. Its IUPAC name is 6-[1-(4-methylphenyl)piperidin-4-yl]oxy-N-[1-(pyridin-4-ylmethyl)piperidin-4-yl]-1-benzothiophene-2-carboxamide.
| Compound Name | 6-[1-(4-methylphenyl)piperidin-4-yl]oxy-N-[1-(pyridin-4-ylmethyl)piperidin-4-yl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 58456833 |
| Molecular Formula | C32H36N4O2S |
| Molecular Weight | 540.73 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | 6-[1-(4-methylphenyl)piperidin-4-yl]oxy-N-[1-(pyridin-4-ylmethyl)piperidin-4-yl]-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc(N2CCC(Oc3ccc4cc(C(=O)NC5CCN(Cc6ccncc6)CC5)sc4c3)CC2)cc1 |
| InChI | InChI=1S/C32H36N4O2S/c1-23-2-5-27(6-3-23)36-18-12-28(13-19-36)38-29-7-4-25-20-31(39-30(25)21-29)32(37)34-26-10-16-35(17-11-26)22-24-8-14-33-15-9-24/h2-9,14-15,20-21,26,28H,10-13,16-19,22H2,1H3,(H,34,37) |
| InChIKey | VLMAVIDSUFQSKX-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.73 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|