C29H32F3N3O2 — CID 58456835
7-pyridin-4-yl-1-[5-[1-[4-(trifluoromethyl)phenyl]piperidin-4-yl]oxy-2-pyridinyl]heptan-1-one (PubChem CID 58456835) has the molecular formula C29H32F3N3O2 and a molecular weight of 511.59 g/mol. Its IUPAC name is 7-pyridin-4-yl-1-[5-[1-[4-(trifluoromethyl)phenyl]piperidin-4-yl]oxy-2-pyridinyl]heptan-1-one.
| Compound Name | 7-pyridin-4-yl-1-[5-[1-[4-(trifluoromethyl)phenyl]piperidin-4-yl]oxy-2-pyridinyl]heptan-1-one |
|---|---|
| PubChem CID | 58456835 |
| Molecular Formula | C29H32F3N3O2 |
| Molecular Weight | 511.59 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 7-pyridin-4-yl-1-[5-[1-[4-(trifluoromethyl)phenyl]piperidin-4-yl]oxy-2-pyridinyl]heptan-1-one |
| SMILES | O=C(CCCCCCc1ccncc1)c1ccc(OC2CCN(c3ccc(C(F)(F)F)cc3)CC2)cn1 |
| InChI | InChI=1S/C29H32F3N3O2/c30-29(31,32)23-7-9-24(10-8-23)35-19-15-25(16-20-35)37-26-11-12-27(34-21-26)28(36)6-4-2-1-3-5-22-13-17-33-18-14-22/h7-14,17-18,21,25H,1-6,15-16,19-20H2 |
| InChIKey | SAQBDWBOLBKOPI-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.59 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|