C32H57ClN2O — CID 58457364
(2R)-1-[(4R)-4-(4-chlorocyclohexyl)-3,3-dimethylpiperidin-1-yl]-N-[[3-(4-methoxycyclohexyl)cyclohexen-1-yl]methyl]-3-methylbutan-2-amine (PubChem CID 58457364) has the molecular formula C32H57ClN2O and a molecular weight of 521.27 g/mol. Its IUPAC name is (2R)-1-[(4R)-4-(4-chlorocyclohexyl)-3,3-dimethylpiperidin-1-yl]-N-[[3-(4-methoxycyclohexyl)cyclohexen-1-yl]methyl]-3-methylbutan-2-amine.
| Compound Name | (2R)-1-[(4R)-4-(4-chlorocyclohexyl)-3,3-dimethylpiperidin-1-yl]-N-[[3-(4-methoxycyclohexyl)cyclohexen-1-yl]methyl]-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 58457364 |
| Molecular Formula | C32H57ClN2O |
| Molecular Weight | 521.27 g/mol |
| Exact Mass | 520.42 |
| IUPAC Name | (2R)-1-[(4R)-4-(4-chlorocyclohexyl)-3,3-dimethylpiperidin-1-yl]-N-[[3-(4-methoxycyclohexyl)cyclohexen-1-yl]methyl]-3-methylbutan-2-amine |
| SMILES | COC1CCC(C2C=C(CN[C@@H](CN3CC[C@H](C4CCC(Cl)CC4)C(C)(C)C3)C(C)C)CCC2)CC1 |
| InChI | InChI=1S/C32H57ClN2O/c1-23(2)31(21-35-18-17-30(32(3,4)22-35)26-9-13-28(33)14-10-26)34-20-24-7-6-8-27(19-24)25-11-15-29(36-5)16-12-25/h19,23,25-31,34H,6-18,20-22H2,1-5H3/t25?,26?,27?,28?,29?,30-,31+/m1/s1 |
| InChIKey | HRDLTJRWSYQHIZ-VHZVALKJSA-N |
| XLogP | 7.68 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.27 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|