C27H48ClFN2O — CID 58457707
(2R)-1-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-N-[[3-fluoro-5-(methoxymethyl)cyclohexyl]methyl]-3-methylbutan-2-amine (PubChem CID 58457707) has the molecular formula C27H48ClFN2O and a molecular weight of 471.15 g/mol. Its IUPAC name is (2R)-1-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-N-[[3-fluoro-5-(methoxymethyl)cyclohexyl]methyl]-3-methylbutan-2-amine.
| Compound Name | (2R)-1-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-N-[[3-fluoro-5-(methoxymethyl)cyclohexyl]methyl]-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 58457707 |
| Molecular Formula | C27H48ClFN2O |
| Molecular Weight | 471.15 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | (2R)-1-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-N-[[3-fluoro-5-(methoxymethyl)cyclohexyl]methyl]-3-methylbutan-2-amine |
| SMILES | COCC1CC(F)CC(CN[C@@H](CN2CCC(C3=CCC(Cl)CC3)C(C)(C)C2)C(C)C)C1 |
| InChI | InChI=1S/C27H48ClFN2O/c1-19(2)26(30-15-20-12-21(17-32-5)14-24(29)13-20)16-31-11-10-25(27(3,4)18-31)22-6-8-23(28)9-7-22/h6,19-21,23-26,30H,7-18H2,1-5H3/t20?,21?,23?,24?,25?,26-/m0/s1 |
| InChIKey | XPHVGQPOVASRJM-QCGXSOLRSA-N |
| XLogP | 6.07 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.15 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|