C27H47ClN2O — CID 58457579
(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)piperidin-1-yl]-3-methyl-N-[[3-(oxolan-3-yl)cyclohexyl]methyl]butan-2-amine (PubChem CID 58457579) has the molecular formula C27H47ClN2O and a molecular weight of 451.14 g/mol. Its IUPAC name is (2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)piperidin-1-yl]-3-methyl-N-[[3-(oxolan-3-yl)cyclohexyl]methyl]butan-2-amine.
| Compound Name | (2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)piperidin-1-yl]-3-methyl-N-[[3-(oxolan-3-yl)cyclohexyl]methyl]butan-2-amine |
|---|---|
| PubChem CID | 58457579 |
| Molecular Formula | C27H47ClN2O |
| Molecular Weight | 451.14 g/mol |
| Exact Mass | 450.34 |
| IUPAC Name | (2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)piperidin-1-yl]-3-methyl-N-[[3-(oxolan-3-yl)cyclohexyl]methyl]butan-2-amine |
| SMILES | CC(C)[C@H](CN1CCC(C2C=CC(Cl)CC2)CC1)NCC1CCCC(C2CCOC2)C1 |
| InChI | InChI=1S/C27H47ClN2O/c1-20(2)27(29-17-21-4-3-5-24(16-21)25-12-15-31-19-25)18-30-13-10-23(11-14-30)22-6-8-26(28)9-7-22/h6,8,20-27,29H,3-5,7,9-19H2,1-2H3/t21?,22?,24?,25?,26?,27-/m0/s1 |
| InChIKey | VYRJMABJZYXGEG-KQMCEJHESA-N |
| XLogP | 5.73 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.14 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|