C28H52ClN3O — CID 58457975
N'-[(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-N-[[4-(methoxymethyl)cyclohexyl]methyl]methanediamine (PubChem CID 58457975) has the molecular formula C28H52ClN3O and a molecular weight of 482.20 g/mol. Its IUPAC name is N'-[(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-N-[[4-(methoxymethyl)cyclohexyl]methyl]methanediamine.
| Compound Name | N'-[(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-N-[[4-(methoxymethyl)cyclohexyl]methyl]methanediamine |
|---|---|
| PubChem CID | 58457975 |
| Molecular Formula | C28H52ClN3O |
| Molecular Weight | 482.20 g/mol |
| Exact Mass | 481.38 |
| IUPAC Name | N'-[(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-N-[[4-(methoxymethyl)cyclohexyl]methyl]methanediamine |
| SMILES | COCC1CCC(CNCN[C@@H](CN2CCC(C3C=CC(Cl)CC3)C(C)(C)C2)C(C)C)CC1 |
| InChI | InChI=1S/C28H52ClN3O/c1-21(2)27(31-20-30-16-22-6-8-23(9-7-22)18-33-5)17-32-15-14-26(28(3,4)19-32)24-10-12-25(29)13-11-24/h10,12,21-27,30-31H,6-9,11,13-20H2,1-5H3/t22?,23?,24?,25?,26?,27-/m0/s1 |
| InChIKey | GFFJVAYBBRCWAP-VNAPNBGHSA-N |
| XLogP | 5.52 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.20 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|