C24H46ClN3O — CID 58457292
N-[(2R)-1-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-N'-(1-methoxy-2-methylpropan-2-yl)methanediamine (PubChem CID 58457292) has the molecular formula C24H46ClN3O and a molecular weight of 428.11 g/mol. Its IUPAC name is N-[(2R)-1-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-N'-(1-methoxy-2-methylpropan-2-yl)methanediamine.
| Compound Name | N-[(2R)-1-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-N'-(1-methoxy-2-methylpropan-2-yl)methanediamine |
|---|---|
| PubChem CID | 58457292 |
| Molecular Formula | C24H46ClN3O |
| Molecular Weight | 428.11 g/mol |
| Exact Mass | 427.33 |
| IUPAC Name | N-[(2R)-1-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-N'-(1-methoxy-2-methylpropan-2-yl)methanediamine |
| SMILES | COCC(C)(C)NCN[C@@H](CN1CCC(C2=CCC(Cl)CC2)C(C)(C)C1)C(C)C |
| InChI | InChI=1S/C24H46ClN3O/c1-18(2)22(26-17-27-24(5,6)16-29-7)14-28-13-12-21(23(3,4)15-28)19-8-10-20(25)11-9-19/h8,18,20-22,26-27H,9-17H2,1-7H3/t20?,21?,22-/m0/s1 |
| InChIKey | WRJONORBFUIENU-HRTMPFAESA-N |
| XLogP | 4.64 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.11 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|