C23H44ClN3O — CID 58457831
N'-[(2R)-1-[4-(4-chlorocyclohex-3-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-N-(2-ethoxyethyl)methanediamine (PubChem CID 58457831) has the molecular formula C23H44ClN3O and a molecular weight of 414.08 g/mol. Its IUPAC name is N'-[(2R)-1-[4-(4-chlorocyclohex-3-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-N-(2-ethoxyethyl)methanediamine.
| Compound Name | N'-[(2R)-1-[4-(4-chlorocyclohex-3-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-N-(2-ethoxyethyl)methanediamine |
|---|---|
| PubChem CID | 58457831 |
| Molecular Formula | C23H44ClN3O |
| Molecular Weight | 414.08 g/mol |
| Exact Mass | 413.32 |
| IUPAC Name | N'-[(2R)-1-[4-(4-chlorocyclohex-3-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-N-(2-ethoxyethyl)methanediamine |
| SMILES | CCOCCNCN[C@@H](CN1CCC(C2CC=C(Cl)CC2)C(C)(C)C1)C(C)C |
| InChI | InChI=1S/C23H44ClN3O/c1-6-28-14-12-25-17-26-22(18(2)3)15-27-13-11-21(23(4,5)16-27)19-7-9-20(24)10-8-19/h9,18-19,21-22,25-26H,6-8,10-17H2,1-5H3/t19?,21?,22-/m0/s1 |
| InChIKey | WEGCLSLCBGDNIC-VTLFHKLASA-N |
| XLogP | 4.46 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.08 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|