C28H48ClN3O — CID 58457333
N'-[(2R)-1-[4-(4-chlorocyclohexa-1,3-dien-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-N-[[6-(methoxymethyl)cyclohex-3-en-1-yl]methyl]methanediamine (PubChem CID 58457333) has the molecular formula C28H48ClN3O and a molecular weight of 478.17 g/mol. Its IUPAC name is N'-[(2R)-1-[4-(4-chlorocyclohexa-1,3-dien-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-N-[[6-(methoxymethyl)cyclohex-3-en-1-yl]methyl]methanediamine.
| Compound Name | N'-[(2R)-1-[4-(4-chlorocyclohexa-1,3-dien-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-N-[[6-(methoxymethyl)cyclohex-3-en-1-yl]methyl]methanediamine |
|---|---|
| PubChem CID | 58457333 |
| Molecular Formula | C28H48ClN3O |
| Molecular Weight | 478.17 g/mol |
| Exact Mass | 477.35 |
| IUPAC Name | N'-[(2R)-1-[4-(4-chlorocyclohexa-1,3-dien-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-N-[[6-(methoxymethyl)cyclohex-3-en-1-yl]methyl]methanediamine |
| SMILES | COCC1CC=CCC1CNCN[C@@H](CN1CCC(C2=CC=C(Cl)CC2)C(C)(C)C1)C(C)C |
| InChI | InChI=1S/C28H48ClN3O/c1-21(2)27(31-20-30-16-23-8-6-7-9-24(23)18-33-5)17-32-15-14-26(28(3,4)19-32)22-10-12-25(29)13-11-22/h6-7,10,12,21,23-24,26-27,30-31H,8-9,11,13-20H2,1-5H3/t23?,24?,26?,27-/m0/s1 |
| InChIKey | NQGLTHIACDCQJB-ADUJOEHUSA-N |
| XLogP | 5.57 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.17 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|