C25H43ClN2O — CID 58457751
(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)piperidin-1-yl]-N-[[3-(methoxymethyl)cyclohex-2-en-1-yl]methyl]-3-methylbutan-2-amine (PubChem CID 58457751) has the molecular formula C25H43ClN2O and a molecular weight of 423.09 g/mol. Its IUPAC name is (2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)piperidin-1-yl]-N-[[3-(methoxymethyl)cyclohex-2-en-1-yl]methyl]-3-methylbutan-2-amine.
| Compound Name | (2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)piperidin-1-yl]-N-[[3-(methoxymethyl)cyclohex-2-en-1-yl]methyl]-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 58457751 |
| Molecular Formula | C25H43ClN2O |
| Molecular Weight | 423.09 g/mol |
| Exact Mass | 422.31 |
| IUPAC Name | (2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)piperidin-1-yl]-N-[[3-(methoxymethyl)cyclohex-2-en-1-yl]methyl]-3-methylbutan-2-amine |
| SMILES | COCC1=CC(CN[C@@H](CN2CCC(C3C=CC(Cl)CC3)CC2)C(C)C)CCC1 |
| InChI | InChI=1S/C25H43ClN2O/c1-19(2)25(27-16-20-5-4-6-21(15-20)18-29-3)17-28-13-11-23(12-14-28)22-7-9-24(26)10-8-22/h7,9,15,19-20,22-25,27H,4-6,8,10-14,16-18H2,1-3H3/t20?,22?,24?,25-/m0/s1 |
| InChIKey | COWPQJQBDZJLCT-BQRWRSFLSA-N |
| XLogP | 5.26 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.09 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|