C26H47ClN2O4 — CID 157123174
(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)piperidin-1-yl]-N-[2-(3,5-dimethoxycyclohexa-1,5-dien-1-yl)ethyl]-3-methylbutan-2-amine;dihydrate (PubChem CID 157123174) has the molecular formula C26H47ClN2O4 and a molecular weight of 487.13 g/mol. Its IUPAC name is (2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)piperidin-1-yl]-N-[2-(3,5-dimethoxycyclohexa-1,5-dien-1-yl)ethyl]-3-methylbutan-2-amine;dihydrate.
| Compound Name | (2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)piperidin-1-yl]-N-[2-(3,5-dimethoxycyclohexa-1,5-dien-1-yl)ethyl]-3-methylbutan-2-amine;dihydrate |
|---|---|
| PubChem CID | 157123174 |
| Molecular Formula | C26H47ClN2O4 |
| Molecular Weight | 487.13 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | (2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)piperidin-1-yl]-N-[2-(3,5-dimethoxycyclohexa-1,5-dien-1-yl)ethyl]-3-methylbutan-2-amine;dihydrate |
| SMILES | COC1=CC(CCN[C@@H](CN2CCC(C3C=CC(Cl)CC3)CC2)C(C)C)=CC(OC)C1.O.O |
| InChI | InChI=1S/C26H43ClN2O2.2H2O/c1-19(2)26(28-12-9-20-15-24(30-3)17-25(16-20)31-4)18-29-13-10-22(11-14-29)21-5-7-23(27)8-6-21;;/h5,7,15-16,19,21-24,26,28H,6,8-14,17-18H2,1-4H3;2*1H2/t21?,23?,24?,26-;;/m0../s1 |
| InChIKey | NTRNBFMLTAOJSF-MAMIRVQMSA-N |
| XLogP | 3.50 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.13 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|