C26H46Cl2N2O — CID 58457402
[2-chloro-5-[[[(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]amino]methyl]cyclohexyl]methanol (PubChem CID 58457402) has the molecular formula C26H46Cl2N2O and a molecular weight of 473.57 g/mol. Its IUPAC name is [2-chloro-5-[[[(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]amino]methyl]cyclohexyl]methanol.
| Compound Name | [2-chloro-5-[[[(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]amino]methyl]cyclohexyl]methanol |
|---|---|
| PubChem CID | 58457402 |
| Molecular Formula | C26H46Cl2N2O |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | [2-chloro-5-[[[(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]amino]methyl]cyclohexyl]methanol |
| SMILES | CC(C)[C@H](CN1CCC(C2C=CC(Cl)CC2)C(C)(C)C1)NCC1CCC(Cl)C(CO)C1 |
| InChI | InChI=1S/C26H46Cl2N2O/c1-18(2)25(29-14-19-5-10-24(28)21(13-19)16-31)15-30-12-11-23(26(3,4)17-30)20-6-8-22(27)9-7-20/h6,8,18-25,29,31H,5,7,9-17H2,1-4H3/t19?,20?,21?,22?,23?,24?,25-/m0/s1 |
| InChIKey | DBOIABGKVATWFY-JIDABFMYSA-N |
| XLogP | 5.54 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|