C26H43ClN2O — CID 58457732
[5-[[[(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]pentan-2-yl]amino]methyl]cyclohexa-2,4-dien-1-yl]methanol (PubChem CID 58457732) has the molecular formula C26H43ClN2O and a molecular weight of 435.10 g/mol. Its IUPAC name is [5-[[[(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]pentan-2-yl]amino]methyl]cyclohexa-2,4-dien-1-yl]methanol.
| Compound Name | [5-[[[(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]pentan-2-yl]amino]methyl]cyclohexa-2,4-dien-1-yl]methanol |
|---|---|
| PubChem CID | 58457732 |
| Molecular Formula | C26H43ClN2O |
| Molecular Weight | 435.10 g/mol |
| Exact Mass | 434.31 |
| IUPAC Name | [5-[[[(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]pentan-2-yl]amino]methyl]cyclohexa-2,4-dien-1-yl]methanol |
| SMILES | CCC[C@H](CN1CCC(C2C=CC(Cl)CC2)C(C)(C)C1)NCC1=CC=CC(CO)C1 |
| InChI | InChI=1S/C26H43ClN2O/c1-4-6-24(28-16-20-7-5-8-21(15-20)18-30)17-29-14-13-25(26(2,3)19-29)22-9-11-23(27)12-10-22/h5,7-9,11,21-25,28,30H,4,6,10,12-19H2,1-3H3/t21?,22?,23?,24-,25?/m1/s1 |
| InChIKey | OMFPMBZFTYUFPB-NIRFSVBPSA-N |
| XLogP | 5.16 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.10 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|