C30H49ClN2O — CID 58457381
7-[[[(2R)-1-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]amino]methyl]-3-methyl-1,2,3,4,8,8a-hexahydronaphthalen-1-ol (PubChem CID 58457381) has the molecular formula C30H49ClN2O and a molecular weight of 489.19 g/mol. Its IUPAC name is 7-[[[(2R)-1-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]amino]methyl]-3-methyl-1,2,3,4,8,8a-hexahydronaphthalen-1-ol.
| Compound Name | 7-[[[(2R)-1-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]amino]methyl]-3-methyl-1,2,3,4,8,8a-hexahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 58457381 |
| Molecular Formula | C30H49ClN2O |
| Molecular Weight | 489.19 g/mol |
| Exact Mass | 488.35 |
| IUPAC Name | 7-[[[(2R)-1-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]amino]methyl]-3-methyl-1,2,3,4,8,8a-hexahydronaphthalen-1-ol |
| SMILES | CC1CC2=CC=C(CN[C@@H](CN3CCC(C4=CCC(Cl)CC4)C(C)(C)C3)C(C)C)CC2C(O)C1 |
| InChI | InChI=1S/C30H49ClN2O/c1-20(2)28(32-17-22-6-7-24-14-21(3)15-29(34)26(24)16-22)18-33-13-12-27(30(4,5)19-33)23-8-10-25(31)11-9-23/h6-8,20-21,25-29,32,34H,9-19H2,1-5H3/t21?,25?,26?,27?,28-,29?/m0/s1 |
| InChIKey | DLXVFXXJMRADGN-ZOFOEHRISA-N |
| XLogP | 6.33 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.19 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|