C24H39ClN2O — CID 58457642
5-[2-[[(2R)-1-[4-(4-chlorocyclohexa-1,5-dien-1-yl)piperidin-1-yl]-3-methylbutan-2-yl]amino]ethyl]cyclohex-3-en-1-ol (PubChem CID 58457642) has the molecular formula C24H39ClN2O and a molecular weight of 407.04 g/mol. Its IUPAC name is 5-[2-[[(2R)-1-[4-(4-chlorocyclohexa-1,5-dien-1-yl)piperidin-1-yl]-3-methylbutan-2-yl]amino]ethyl]cyclohex-3-en-1-ol.
| Compound Name | 5-[2-[[(2R)-1-[4-(4-chlorocyclohexa-1,5-dien-1-yl)piperidin-1-yl]-3-methylbutan-2-yl]amino]ethyl]cyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 58457642 |
| Molecular Formula | C24H39ClN2O |
| Molecular Weight | 407.04 g/mol |
| Exact Mass | 406.28 |
| IUPAC Name | 5-[2-[[(2R)-1-[4-(4-chlorocyclohexa-1,5-dien-1-yl)piperidin-1-yl]-3-methylbutan-2-yl]amino]ethyl]cyclohex-3-en-1-ol |
| SMILES | CC(C)[C@H](CN1CCC(C2=CCC(Cl)C=C2)CC1)NCCC1C=CCC(O)C1 |
| InChI | InChI=1S/C24H39ClN2O/c1-18(2)24(26-13-10-19-4-3-5-23(28)16-19)17-27-14-11-21(12-15-27)20-6-8-22(25)9-7-20/h3-4,6-8,18-19,21-24,26,28H,5,9-17H2,1-2H3/t19?,22?,23?,24-/m0/s1 |
| InChIKey | KTHGISFOEIFCOP-NCXVZUCISA-N |
| XLogP | 4.52 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.04 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|