C16H24FN — CID 58458290
4-(4-fluorophenyl)-2,6-dimethyl-5-methylideneheptan-2-amine (PubChem CID 58458290) has the molecular formula C16H24FN and a molecular weight of 249.37 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-2,6-dimethyl-5-methylideneheptan-2-amine.
| Compound Name | 4-(4-fluorophenyl)-2,6-dimethyl-5-methylideneheptan-2-amine |
|---|---|
| PubChem CID | 58458290 |
| Molecular Formula | C16H24FN |
| Molecular Weight | 249.37 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | 4-(4-fluorophenyl)-2,6-dimethyl-5-methylideneheptan-2-amine |
| SMILES | C=C(C(C)C)C(CC(C)(C)N)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H24FN/c1-11(2)12(3)15(10-16(4,5)18)13-6-8-14(17)9-7-13/h6-9,11,15H,3,10,18H2,1-2,4-5H3 |
| InChIKey | WNGWUMZOYDFIOF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.37 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|