C18H26ClNO — CID 58458342
1-[(2R)-2-(4-chlorophenyl)-4-methyl-3-methylidenepentyl]piperidin-4-ol (PubChem CID 58458342) has the molecular formula C18H26ClNO and a molecular weight of 307.87 g/mol. Its IUPAC name is 1-[(2R)-2-(4-chlorophenyl)-4-methyl-3-methylidenepentyl]piperidin-4-ol.
| Compound Name | 1-[(2R)-2-(4-chlorophenyl)-4-methyl-3-methylidenepentyl]piperidin-4-ol |
|---|---|
| PubChem CID | 58458342 |
| Molecular Formula | C18H26ClNO |
| Molecular Weight | 307.87 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 1-[(2R)-2-(4-chlorophenyl)-4-methyl-3-methylidenepentyl]piperidin-4-ol |
| SMILES | C=C(C(C)C)[C@@H](CN1CCC(O)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H26ClNO/c1-13(2)14(3)18(15-4-6-16(19)7-5-15)12-20-10-8-17(21)9-11-20/h4-7,13,17-18,21H,3,8-12H2,1-2H3/t18-/m1/s1 |
| InChIKey | GWGMURLRILKXNK-GOSISDBHSA-N |
| XLogP | 4.09 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.87 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|