C27H24N2 — CID 58461083
2-[3-(9,9-dimethylfluoren-3-yl)phenyl]-3,5-dimethylpyrazine (PubChem CID 58461083) has the molecular formula C27H24N2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 2-[3-(9,9-dimethylfluoren-3-yl)phenyl]-3,5-dimethylpyrazine.
| Compound Name | 2-[3-(9,9-dimethylfluoren-3-yl)phenyl]-3,5-dimethylpyrazine |
|---|---|
| PubChem CID | 58461083 |
| Molecular Formula | C27H24N2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 2-[3-(9,9-dimethylfluoren-3-yl)phenyl]-3,5-dimethylpyrazine |
| SMILES | Cc1cnc(-c2cccc(-c3ccc4c(c3)-c3ccccc3C4(C)C)c2)c(C)n1 |
| InChI | InChI=1S/C27H24N2/c1-17-16-28-26(18(2)29-17)21-9-7-8-19(14-21)20-12-13-25-23(15-20)22-10-5-6-11-24(22)27(25,3)4/h5-16H,1-4H3 |
| InChIKey | ADGYWGQVPMXCTM-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |