C31H38N4O7 — CID 58461380
(4R,4aR,5aS,12aS)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[3-(1-methylpyrrol-2-yl)propyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58461380) has the molecular formula C31H38N4O7 and a molecular weight of 578.67 g/mol. Its IUPAC name is (4R,4aR,5aS,12aS)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[3-(1-methylpyrrol-2-yl)propyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aS,12aS)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[3-(1-methylpyrrol-2-yl)propyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58461380 |
| Molecular Formula | C31H38N4O7 |
| Molecular Weight | 578.67 g/mol |
| Exact Mass | 578.27 |
| IUPAC Name | (4R,4aR,5aS,12aS)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[3-(1-methylpyrrol-2-yl)propyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(CCCc2cccn2C)c(O)c2c1C[C@@H]1C[C@@H]3[C@@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C31H38N4O7/c1-33(2)20-14-15(8-6-9-17-10-7-11-35(17)5)25(36)22-18(20)12-16-13-19-24(34(3)4)27(38)23(30(32)41)29(40)31(19,42)28(39)21(16)26(22)37/h7,10-11,14,16,19,24,36-37,40,42H,6,8-9,12-13H2,1-5H3,(H2,32,41)/t16-,19-,24-,31-/m1/s1 |
| InChIKey | MPWXAUXNBGJSRG-BJQQSFONSA-N |
| XLogP | 1.54 |
| TPSA | 169.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.67 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|