C22H24N2O10 — CID 58461432
(4R,4aS,5R,5aS,12aS)-4-(dimethylamino)-1,5,6,10,11,12a-hexahydroxy-6-(hydroxymethyl)-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide (PubChem CID 58461432) has the molecular formula C22H24N2O10 and a molecular weight of 476.44 g/mol. Its IUPAC name is (4R,4aS,5R,5aS,12aS)-4-(dimethylamino)-1,5,6,10,11,12a-hexahydroxy-6-(hydroxymethyl)-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aS,5R,5aS,12aS)-4-(dimethylamino)-1,5,6,10,11,12a-hexahydroxy-6-(hydroxymethyl)-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 58461432 |
| Molecular Formula | C22H24N2O10 |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | (4R,4aS,5R,5aS,12aS)-4-(dimethylamino)-1,5,6,10,11,12a-hexahydroxy-6-(hydroxymethyl)-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@H]1C(=O)C(C(N)=O)=C(O)[C@]2(O)C(=O)C3=C(O)c4c(O)cccc4C(O)(CO)[C@@H]3[C@@H](O)[C@H]12 |
| InChI | InChI=1S/C22H24N2O10/c1-24(2)14-13-17(29)12-10(18(30)22(13,34)19(31)11(16(14)28)20(23)32)15(27)9-7(21(12,33)6-25)4-3-5-8(9)26/h3-5,12-14,17,25-27,29,31,33-34H,6H2,1-2H3,(H2,23,32)/t12-,13-,14+,17+,21?,22+/m0/s1 |
| InChIKey | GXSXBKIOOBYKBW-GBUIDMNKSA-N |
| XLogP | -2.43 |
| TPSA | 222.08 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|