C19H29NO5 — CID 58461545
(R)-[(4R,5S)-5-[(benzylamino)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-(2,2-dimethyl-1,3-dioxolan-4-yl)methanol (PubChem CID 58461545) has the molecular formula C19H29NO5 and a molecular weight of 351.44 g/mol. Its IUPAC name is (R)-[(4R,5S)-5-[(benzylamino)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-(2,2-dimethyl-1,3-dioxolan-4-yl)methanol.
| Compound Name | (R)-[(4R,5S)-5-[(benzylamino)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-(2,2-dimethyl-1,3-dioxolan-4-yl)methanol |
|---|---|
| PubChem CID | 58461545 |
| Molecular Formula | C19H29NO5 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | (R)-[(4R,5S)-5-[(benzylamino)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-(2,2-dimethyl-1,3-dioxolan-4-yl)methanol |
| SMILES | CC1(C)OCC([C@@H](O)[C@H]2OC(C)(C)O[C@H]2CNCc2ccccc2)O1 |
| InChI | InChI=1S/C19H29NO5/c1-18(2)22-12-15(24-18)16(21)17-14(23-19(3,4)25-17)11-20-10-13-8-6-5-7-9-13/h5-9,14-17,20-21H,10-12H2,1-4H3/t14-,15?,16+,17-/m0/s1 |
| InChIKey | YTGGEAMUMGIGHK-CYBCNJLJSA-N |
| XLogP | 1.81 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |