C20H26N2O10P2-4 — CID 58461582
2-[[[1-hydroxy-3-[(2-hydroxyphenyl)methyl-(phosphonatomethyl)amino]propan-2-yl]-(phosphonatomethyl)amino]methyl]-4-(hydroxymethyl)phenol (PubChem CID 58461582) has the molecular formula C20H26N2O10P2-4 and a molecular weight of 516.38 g/mol. Its IUPAC name is 2-[[[1-hydroxy-3-[(2-hydroxyphenyl)methyl-(phosphonatomethyl)amino]propan-2-yl]-(phosphonatomethyl)amino]methyl]-4-(hydroxymethyl)phenol.
| Compound Name | 2-[[[1-hydroxy-3-[(2-hydroxyphenyl)methyl-(phosphonatomethyl)amino]propan-2-yl]-(phosphonatomethyl)amino]methyl]-4-(hydroxymethyl)phenol |
|---|---|
| PubChem CID | 58461582 |
| Molecular Formula | C20H26N2O10P2-4 |
| Molecular Weight | 516.38 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | 2-[[[1-hydroxy-3-[(2-hydroxyphenyl)methyl-(phosphonatomethyl)amino]propan-2-yl]-(phosphonatomethyl)amino]methyl]-4-(hydroxymethyl)phenol |
| SMILES | O=P([O-])([O-])CN(Cc1ccccc1O)CC(CO)N(Cc1cc(CO)ccc1O)CP(=O)([O-])[O-] |
| InChI | InChI=1S/C20H30N2O10P2/c23-11-15-5-6-20(26)17(7-15)9-22(14-34(30,31)32)18(12-24)10-21(13-33(27,28)29)8-16-3-1-2-4-19(16)25/h1-7,18,23-26H,8-14H2,(H2,27,28,29)(H2,30,31,32)/p-4 |
| InChIKey | XHSVAONVXCKJKB-UHFFFAOYSA-J |
| XLogP | -2.00 |
| TPSA | 213.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.38 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|