C19H26S — CID 58462658
2,3-di(propan-2-yl)-5-(3-propan-2-ylphenyl)thiophene (PubChem CID 58462658) has the molecular formula C19H26S and a molecular weight of 286.48 g/mol. Its IUPAC name is 2,3-di(propan-2-yl)-5-(3-propan-2-ylphenyl)thiophene.
| Compound Name | 2,3-di(propan-2-yl)-5-(3-propan-2-ylphenyl)thiophene |
|---|---|
| PubChem CID | 58462658 |
| Molecular Formula | C19H26S |
| Molecular Weight | 286.48 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 2,3-di(propan-2-yl)-5-(3-propan-2-ylphenyl)thiophene |
| SMILES | CC(C)c1cccc(-c2cc(C(C)C)c(C(C)C)s2)c1 |
| InChI | InChI=1S/C19H26S/c1-12(2)15-8-7-9-16(10-15)18-11-17(13(3)4)19(20-18)14(5)6/h7-14H,1-6H3 |
| InChIKey | CUESQRAVTGXJIP-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.48 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |