C21H16Cl2N2OS — CID 58463341
[2-(2-chlorophenyl)-4-(5-chlorothiophen-2-yl)-1-methylpyrrol-3-yl]-pyridin-3-ylmethanol (PubChem CID 58463341) has the molecular formula C21H16Cl2N2OS and a molecular weight of 415.35 g/mol. Its IUPAC name is [2-(2-chlorophenyl)-4-(5-chlorothiophen-2-yl)-1-methylpyrrol-3-yl]-pyridin-3-ylmethanol.
| Compound Name | [2-(2-chlorophenyl)-4-(5-chlorothiophen-2-yl)-1-methylpyrrol-3-yl]-pyridin-3-ylmethanol |
|---|---|
| PubChem CID | 58463341 |
| Molecular Formula | C21H16Cl2N2OS |
| Molecular Weight | 415.35 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | [2-(2-chlorophenyl)-4-(5-chlorothiophen-2-yl)-1-methylpyrrol-3-yl]-pyridin-3-ylmethanol |
| SMILES | Cn1cc(-c2ccc(Cl)s2)c(C(O)c2cccnc2)c1-c1ccccc1Cl |
| InChI | InChI=1S/C21H16Cl2N2OS/c1-25-12-15(17-8-9-18(23)27-17)19(21(26)13-5-4-10-24-11-13)20(25)14-6-2-3-7-16(14)22/h2-12,21,26H,1H3 |
| InChIKey | HTOJIVXIZQWWBC-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.35 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |