C20H13Cl2NO2S — CID 58463418
[2-(3-chlorophenyl)-4-(5-chlorothiophen-2-yl)furan-3-yl]-pyridin-3-ylmethanol (PubChem CID 58463418) has the molecular formula C20H13Cl2NO2S and a molecular weight of 402.30 g/mol. Its IUPAC name is [2-(3-chlorophenyl)-4-(5-chlorothiophen-2-yl)furan-3-yl]-pyridin-3-ylmethanol.
| Compound Name | [2-(3-chlorophenyl)-4-(5-chlorothiophen-2-yl)furan-3-yl]-pyridin-3-ylmethanol |
|---|---|
| PubChem CID | 58463418 |
| Molecular Formula | C20H13Cl2NO2S |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 401.00 |
| IUPAC Name | [2-(3-chlorophenyl)-4-(5-chlorothiophen-2-yl)furan-3-yl]-pyridin-3-ylmethanol |
| SMILES | OC(c1cccnc1)c1c(-c2ccc(Cl)s2)coc1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H13Cl2NO2S/c21-14-5-1-3-12(9-14)20-18(19(24)13-4-2-8-23-10-13)15(11-25-20)16-6-7-17(22)26-16/h1-11,19,24H |
| InChIKey | DTOXKGURDCODHK-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |