About [2,4-bis(2,4-dichlorophenyl)thiophen-3-yl]-pyridin-3-ylmethanol
[2,4-bis(2,4-dichlorophenyl)thiophen-3-yl]-pyridin-3-ylmethanol (PubChem CID 24745417) has the molecular formula C22H13Cl4NOS
and a molecular weight of 481.23 g/mol. Its IUPAC name is [2,4-bis(2,4-dichlorophenyl)thiophen-3-yl]-pyridin-3-ylmethanol.
Molecular Properties
| Compound Name | [2,4-bis(2,4-dichlorophenyl)thiophen-3-yl]-pyridin-3-ylmethanol |
| PubChem CID | 24745417 |
| Molecular Formula | C22H13Cl4NOS |
| Molecular Weight | 481.23 g/mol |
| Exact Mass | 478.95 |
| IUPAC Name | [2,4-bis(2,4-dichlorophenyl)thiophen-3-yl]-pyridin-3-ylmethanol |
| SMILES | OC(c1cccnc1)c1c(-c2ccc(Cl)cc2Cl)csc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H13Cl4NOS/c23-13-3-5-15(18(25)8-13)17-11-29-22(16-6-4-14(24)9-19(16)26)20(17)21(28)12-2-1-7-27-10-12/h1-11,21,28H |
| InChIKey | CFEIFAWUHUKTRE-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 481.23 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2,4-bis(2,4-dichlorophenyl)thiophen-3-yl]-pyridin-3-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,4-bis(2,4-dichlorophenyl)thiophen-3-yl]-pyridin-3-ylmethanol?
The IUPAC name of [2,4-bis(2,4-dichlorophenyl)thiophen-3-yl]-pyridin-3-ylmethanol (CID 24745417) is [2,4-bis(2,4-dichlorophenyl)thiophen-3-yl]-pyridin-3-ylmethanol.
What is the SMILES notation for [2,4-bis(2,4-dichlorophenyl)thiophen-3-yl]-pyridin-3-ylmethanol?
The canonical SMILES for [2,4-bis(2,4-dichlorophenyl)thiophen-3-yl]-pyridin-3-ylmethanol is OC(c1cccnc1)c1c(-c2ccc(Cl)cc2Cl)csc1-c1ccc(Cl)cc1Cl.
What is the InChIKey of [2,4-bis(2,4-dichlorophenyl)thiophen-3-yl]-pyridin-3-ylmethanol?
The InChIKey is CFEIFAWUHUKTRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H13Cl4NOS/c23-13-3-5-15(18(25)8-13)17-11-29-22(16-6-4-14(24)9-19(16)26)20(17)21(28)12-2-1-7-27-10-12/h1-11,21,28H.
What are the key properties of [2,4-bis(2,4-dichlorophenyl)thiophen-3-yl]-pyridin-3-ylmethanol?
[2,4-bis(2,4-dichlorophenyl)thiophen-3-yl]-pyridin-3-ylmethanol has a molecular weight of 481.23 g/mol, XLogP of 8.17, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2,4-bis(2,4-dichlorophenyl)thiophen-3-yl]-pyridin-3-ylmethanol is sourced from PubChem (CID 24745417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).