C22H13Cl4NOS — CID 24745417
[2,4-bis(2,4-dichlorophenyl)thiophen-3-yl]-pyridin-3-ylmethanol (PubChem CID 24745417) has the molecular formula C22H13Cl4NOS and a molecular weight of 481.23 g/mol. Its IUPAC name is [2,4-bis(2,4-dichlorophenyl)thiophen-3-yl]-pyridin-3-ylmethanol.
| Compound Name | [2,4-bis(2,4-dichlorophenyl)thiophen-3-yl]-pyridin-3-ylmethanol |
|---|---|
| PubChem CID | 24745417 |
| Molecular Formula | C22H13Cl4NOS |
| Molecular Weight | 481.23 g/mol |
| Exact Mass | 478.95 |
| IUPAC Name | [2,4-bis(2,4-dichlorophenyl)thiophen-3-yl]-pyridin-3-ylmethanol |
| SMILES | OC(c1cccnc1)c1c(-c2ccc(Cl)cc2Cl)csc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H13Cl4NOS/c23-13-3-5-15(18(25)8-13)17-11-29-22(16-6-4-14(24)9-19(16)26)20(17)21(28)12-2-1-7-27-10-12/h1-11,21,28H |
| InChIKey | CFEIFAWUHUKTRE-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.23 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |