About [5-(2-chloro-4-fluorophenyl)-3-(2,4-difluorophenyl)-1,2-oxazol-4-yl]-pyridin-3-ylmethanol
[5-(2-chloro-4-fluorophenyl)-3-(2,4-difluorophenyl)-1,2-oxazol-4-yl]-pyridin-3-ylmethanol (PubChem CID 58463288) has the molecular formula C21H12ClF3N2O2
and a molecular weight of 416.79 g/mol. Its IUPAC name is [5-(2-chloro-4-fluorophenyl)-3-(2,4-difluorophenyl)-1,2-oxazol-4-yl]-pyridin-3-ylmethanol.
Molecular Properties
| Compound Name | [5-(2-chloro-4-fluorophenyl)-3-(2,4-difluorophenyl)-1,2-oxazol-4-yl]-pyridin-3-ylmethanol |
| PubChem CID | 58463288 |
| Molecular Formula | C21H12ClF3N2O2 |
| Molecular Weight | 416.79 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | [5-(2-chloro-4-fluorophenyl)-3-(2,4-difluorophenyl)-1,2-oxazol-4-yl]-pyridin-3-ylmethanol |
| SMILES | OC(c1cccnc1)c1c(-c2ccc(F)cc2F)noc1-c1ccc(F)cc1Cl |
| InChI | InChI=1S/C21H12ClF3N2O2/c22-16-8-12(23)3-5-14(16)21-18(20(28)11-2-1-7-26-10-11)19(27-29-21)15-6-4-13(24)9-17(15)25/h1-10,20,28H |
| InChIKey | BUBJDEVOMATXCE-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.79 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(2-chloro-4-fluorophenyl)-3-(2,4-difluorophenyl)-1,2-oxazol-4-yl]-pyridin-3-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2-chloro-4-fluorophenyl)-3-(2,4-difluorophenyl)-1,2-oxazol-4-yl]-pyridin-3-ylmethanol?
The IUPAC name of [5-(2-chloro-4-fluorophenyl)-3-(2,4-difluorophenyl)-1,2-oxazol-4-yl]-pyridin-3-ylmethanol (CID 58463288) is [5-(2-chloro-4-fluorophenyl)-3-(2,4-difluorophenyl)-1,2-oxazol-4-yl]-pyridin-3-ylmethanol.
What is the SMILES notation for [5-(2-chloro-4-fluorophenyl)-3-(2,4-difluorophenyl)-1,2-oxazol-4-yl]-pyridin-3-ylmethanol?
The canonical SMILES for [5-(2-chloro-4-fluorophenyl)-3-(2,4-difluorophenyl)-1,2-oxazol-4-yl]-pyridin-3-ylmethanol is OC(c1cccnc1)c1c(-c2ccc(F)cc2F)noc1-c1ccc(F)cc1Cl.
What is the InChIKey of [5-(2-chloro-4-fluorophenyl)-3-(2,4-difluorophenyl)-1,2-oxazol-4-yl]-pyridin-3-ylmethanol?
The InChIKey is BUBJDEVOMATXCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H12ClF3N2O2/c22-16-8-12(23)3-5-14(16)21-18(20(28)11-2-1-7-26-10-11)19(27-29-21)15-6-4-13(24)9-17(15)25/h1-10,20,28H.
What are the key properties of [5-(2-chloro-4-fluorophenyl)-3-(2,4-difluorophenyl)-1,2-oxazol-4-yl]-pyridin-3-ylmethanol?
[5-(2-chloro-4-fluorophenyl)-3-(2,4-difluorophenyl)-1,2-oxazol-4-yl]-pyridin-3-ylmethanol has a molecular weight of 416.79 g/mol, XLogP of 5.56, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2-chloro-4-fluorophenyl)-3-(2,4-difluorophenyl)-1,2-oxazol-4-yl]-pyridin-3-ylmethanol is sourced from PubChem (CID 58463288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).