C16H10ClF3N2O2 — CID 142794262
[3-[chloro(fluoro)methyl]-5-(2,4-difluorophenyl)-1,2-oxazol-4-yl]-pyridin-3-ylmethanol (PubChem CID 142794262) has the molecular formula C16H10ClF3N2O2 and a molecular weight of 354.72 g/mol. Its IUPAC name is [3-[chloro(fluoro)methyl]-5-(2,4-difluorophenyl)-1,2-oxazol-4-yl]-pyridin-3-ylmethanol.
| Compound Name | [3-[chloro(fluoro)methyl]-5-(2,4-difluorophenyl)-1,2-oxazol-4-yl]-pyridin-3-ylmethanol |
|---|---|
| PubChem CID | 142794262 |
| Molecular Formula | C16H10ClF3N2O2 |
| Molecular Weight | 354.72 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | [3-[chloro(fluoro)methyl]-5-(2,4-difluorophenyl)-1,2-oxazol-4-yl]-pyridin-3-ylmethanol |
| SMILES | OC(c1cccnc1)c1c(C(F)Cl)noc1-c1ccc(F)cc1F |
| InChI | InChI=1S/C16H10ClF3N2O2/c17-16(20)13-12(14(23)8-2-1-5-21-7-8)15(24-22-13)10-4-3-9(18)6-11(10)19/h1-7,14,16,23H |
| InChIKey | MZJXRAAOKAOTCZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.72 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|