C22H14ClF2NO2 — CID 58463425
[4-(4-chloro-2-fluorophenyl)-2-(4-fluorophenyl)furan-3-yl]-pyridin-3-ylmethanol (PubChem CID 58463425) has the molecular formula C22H14ClF2NO2 and a molecular weight of 397.81 g/mol. Its IUPAC name is [4-(4-chloro-2-fluorophenyl)-2-(4-fluorophenyl)furan-3-yl]-pyridin-3-ylmethanol.
| Compound Name | [4-(4-chloro-2-fluorophenyl)-2-(4-fluorophenyl)furan-3-yl]-pyridin-3-ylmethanol |
|---|---|
| PubChem CID | 58463425 |
| Molecular Formula | C22H14ClF2NO2 |
| Molecular Weight | 397.81 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | [4-(4-chloro-2-fluorophenyl)-2-(4-fluorophenyl)furan-3-yl]-pyridin-3-ylmethanol |
| SMILES | OC(c1cccnc1)c1c(-c2ccc(Cl)cc2F)coc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C22H14ClF2NO2/c23-15-5-8-17(19(25)10-15)18-12-28-22(13-3-6-16(24)7-4-13)20(18)21(27)14-2-1-9-26-11-14/h1-12,21,27H |
| InChIKey | WIPCQYOXXRIRMZ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.81 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |