About 3-[(4R)-azepan-4-yl]-1,1,1-trifluoropropan-2-one
3-[(4R)-azepan-4-yl]-1,1,1-trifluoropropan-2-one (PubChem CID 58465003) has the molecular formula C9H14F3NO
and a molecular weight of 209.21 g/mol. Its IUPAC name is 3-[(4R)-azepan-4-yl]-1,1,1-trifluoropropan-2-one.
Molecular Properties
| Compound Name | 3-[(4R)-azepan-4-yl]-1,1,1-trifluoropropan-2-one |
| PubChem CID | 58465003 |
| Molecular Formula | C9H14F3NO |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 3-[(4R)-azepan-4-yl]-1,1,1-trifluoropropan-2-one |
| SMILES | O=C(C[C@@H]1CCCNCC1)C(F)(F)F |
| InChI | InChI=1S/C9H14F3NO/c10-9(11,12)8(14)6-7-2-1-4-13-5-3-7/h7,13H,1-6H2/t7-/m1/s1 |
| InChIKey | KGXSHMVBKBPOLT-SSDOTTSWSA-N |
| XLogP | 1.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(4R)-azepan-4-yl]-1,1,1-trifluoropropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4R)-azepan-4-yl]-1,1,1-trifluoropropan-2-one?
The IUPAC name of 3-[(4R)-azepan-4-yl]-1,1,1-trifluoropropan-2-one (CID 58465003) is 3-[(4R)-azepan-4-yl]-1,1,1-trifluoropropan-2-one.
What is the SMILES notation for 3-[(4R)-azepan-4-yl]-1,1,1-trifluoropropan-2-one?
The canonical SMILES for 3-[(4R)-azepan-4-yl]-1,1,1-trifluoropropan-2-one is O=C(C[C@@H]1CCCNCC1)C(F)(F)F.
What is the InChIKey of 3-[(4R)-azepan-4-yl]-1,1,1-trifluoropropan-2-one?
The InChIKey is KGXSHMVBKBPOLT-SSDOTTSWSA-N. The full InChI is InChI=1S/C9H14F3NO/c10-9(11,12)8(14)6-7-2-1-4-13-5-3-7/h7,13H,1-6H2/t7-/m1/s1.
What are the key properties of 3-[(4R)-azepan-4-yl]-1,1,1-trifluoropropan-2-one?
3-[(4R)-azepan-4-yl]-1,1,1-trifluoropropan-2-one has a molecular weight of 209.21 g/mol, XLogP of 1.90, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4R)-azepan-4-yl]-1,1,1-trifluoropropan-2-one is sourced from PubChem (CID 58465003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).