C17H9ClN2O2 — CID 58466246
1-chloro-8-pyridin-3-ylchromeno[3,2-c]pyridin-10-one (PubChem CID 58466246) has the molecular formula C17H9ClN2O2 and a molecular weight of 308.72 g/mol. Its IUPAC name is 1-chloro-8-pyridin-3-ylchromeno[3,2-c]pyridin-10-one.
| Compound Name | 1-chloro-8-pyridin-3-ylchromeno[3,2-c]pyridin-10-one |
|---|---|
| PubChem CID | 58466246 |
| Molecular Formula | C17H9ClN2O2 |
| Molecular Weight | 308.72 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 1-chloro-8-pyridin-3-ylchromeno[3,2-c]pyridin-10-one |
| SMILES | O=c1c2cc(-c3cccnc3)ccc2oc2ccnc(Cl)c12 |
| InChI | InChI=1S/C17H9ClN2O2/c18-17-15-14(5-7-20-17)22-13-4-3-10(8-12(13)16(15)21)11-2-1-6-19-9-11/h1-9H |
| InChIKey | XGDJAPWIXXJZNH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.72 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|