C17H18N4O — CID 58466567
3-methyl-8'-pyrimidin-5-ylspiro[1,3-oxazolidine-4,3'-2,4-dihydro-1H-naphthalene]-2-imine (PubChem CID 58466567) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is 3-methyl-8'-pyrimidin-5-ylspiro[1,3-oxazolidine-4,3'-2,4-dihydro-1H-naphthalene]-2-imine.
| Compound Name | 3-methyl-8'-pyrimidin-5-ylspiro[1,3-oxazolidine-4,3'-2,4-dihydro-1H-naphthalene]-2-imine |
|---|---|
| PubChem CID | 58466567 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 3-methyl-8'-pyrimidin-5-ylspiro[1,3-oxazolidine-4,3'-2,4-dihydro-1H-naphthalene]-2-imine |
| SMILES | [H]/N=C1\OCC2(CCc3c(cccc3-c3cncnc3)C2)N1C |
| InChI | InChI=1S/C17H18N4O/c1-21-16(18)22-10-17(21)6-5-15-12(7-17)3-2-4-14(15)13-8-19-11-20-9-13/h2-4,8-9,11,18H,5-7,10H2,1H3/b18-16- |
| InChIKey | MTZYFPKDQIVNBZ-VLGSPTGOSA-N |
| XLogP | 2.27 |
| TPSA | 62.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|