C19H22N4O — CID 136657359
N,5,5-trimethyl-8'-pyrimidin-5-ylspiro[1,3-oxazolidine-4,3'-2,4-dihydro-1H-naphthalene]-2-imine (PubChem CID 136657359) has the molecular formula C19H22N4O and a molecular weight of 322.41 g/mol. Its IUPAC name is N,5,5-trimethyl-8'-pyrimidin-5-ylspiro[1,3-oxazolidine-4,3'-2,4-dihydro-1H-naphthalene]-2-imine.
| Compound Name | N,5,5-trimethyl-8'-pyrimidin-5-ylspiro[1,3-oxazolidine-4,3'-2,4-dihydro-1H-naphthalene]-2-imine |
|---|---|
| PubChem CID | 136657359 |
| Molecular Formula | C19H22N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | N,5,5-trimethyl-8'-pyrimidin-5-ylspiro[1,3-oxazolidine-4,3'-2,4-dihydro-1H-naphthalene]-2-imine |
| SMILES | C/N=C1/NC2(CCc3c(cccc3-c3cncnc3)C2)C(C)(C)O1 |
| InChI | InChI=1S/C19H22N4O/c1-18(2)19(23-17(20-3)24-18)8-7-16-13(9-19)5-4-6-15(16)14-10-21-12-22-11-14/h4-6,10-12H,7-9H2,1-3H3,(H,20,23) |
| InChIKey | MWJMBNODNWASCI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|