C16H27N3O4 — CID 58467820
tert-butyl 3-[2-[(3R)-2-oxopiperidin-3-yl]acetyl]piperazine-1-carboxylate (PubChem CID 58467820) has the molecular formula C16H27N3O4 and a molecular weight of 325.41 g/mol. Its IUPAC name is tert-butyl 3-[2-[(3R)-2-oxopiperidin-3-yl]acetyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-[(3R)-2-oxopiperidin-3-yl]acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 58467820 |
| Molecular Formula | C16H27N3O4 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | tert-butyl 3-[2-[(3R)-2-oxopiperidin-3-yl]acetyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCNC(C(=O)C[C@H]2CCCNC2=O)C1 |
| InChI | InChI=1S/C16H27N3O4/c1-16(2,3)23-15(22)19-8-7-17-12(10-19)13(20)9-11-5-4-6-18-14(11)21/h11-12,17H,4-10H2,1-3H3,(H,18,21)/t11-,12?/m1/s1 |
| InChIKey | NWPVCYPPQSWSAM-JHJMLUEUSA-N |
| XLogP | 0.68 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |