C11H22NO3+ — CID 58468451
[(8E)-2,4,10-trihydroxyundeca-8,10-dienyl]azanium (PubChem CID 58468451) has the molecular formula C11H22NO3+ and a molecular weight of 216.30 g/mol. Its IUPAC name is [(8E)-2,4,10-trihydroxyundeca-8,10-dienyl]azanium.
| Compound Name | [(8E)-2,4,10-trihydroxyundeca-8,10-dienyl]azanium |
|---|---|
| PubChem CID | 58468451 |
| Molecular Formula | C11H22NO3+ |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | [(8E)-2,4,10-trihydroxyundeca-8,10-dienyl]azanium |
| SMILES | C=C(O)/C=C/CCCC(O)CC(O)C[NH3+] |
| InChI | InChI=1S/C11H21NO3/c1-9(13)5-3-2-4-6-10(14)7-11(15)8-12/h3,5,10-11,13-15H,1-2,4,6-8,12H2/p+1/b5-3+ |
| InChIKey | XISFVTRLRSCLFD-HWKANZROSA-O |
| XLogP | 0.14 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|