C35H62O3Si — CID 58469037
[(1S,4R,6R,8R,10S,11R,12S,13R,16S,18S)-4,6,8,12,17,17,18-heptamethyl-11-triethylsilyloxy-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]methanol (PubChem CID 58469037) has the molecular formula C35H62O3Si and a molecular weight of 558.96 g/mol. Its IUPAC name is [(1S,4R,6R,8R,10S,11R,12S,13R,16S,18S)-4,6,8,12,17,17,18-heptamethyl-11-triethylsilyloxy-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]methanol.
| Compound Name | [(1S,4R,6R,8R,10S,11R,12S,13R,16S,18S)-4,6,8,12,17,17,18-heptamethyl-11-triethylsilyloxy-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]methanol |
|---|---|
| PubChem CID | 58469037 |
| Molecular Formula | C35H62O3Si |
| Molecular Weight | 558.96 g/mol |
| Exact Mass | 558.45 |
| IUPAC Name | [(1S,4R,6R,8R,10S,11R,12S,13R,16S,18S)-4,6,8,12,17,17,18-heptamethyl-11-triethylsilyloxy-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]methanol |
| SMILES | CC[Si](CC)(CC)O[C@H]1[C@H]2O[C@@](C)(CO)CC(C)C2[C@@]2(C)CC[C@@]34CC35CC[C@H](C)C(C)(C)[C@@H]5CC[C@H]4[C@]12C |
| InChI | InChI=1S/C35H62O3Si/c1-11-39(12-2,13-3)38-29-28-27(23(4)20-31(8,22-36)37-28)32(9)18-19-35-21-34(35)17-16-24(5)30(6,7)25(34)14-15-26(35)33(29,32)10/h23-29,36H,11-22H2,1-10H3/t23?,24-,25-,26-,27?,28-,29-,31+,32+,33+,34?,35-/m0/s1 |
| InChIKey | ZEYCSANVRFJMAG-YXXFWKORSA-N |
| XLogP | 8.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.96 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|