C11H24N2O — CID 58469260
1-(2,4-dimethylpentan-3-yl)-1,3,3-trimethylurea (PubChem CID 58469260) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is 1-(2,4-dimethylpentan-3-yl)-1,3,3-trimethylurea.
| Compound Name | 1-(2,4-dimethylpentan-3-yl)-1,3,3-trimethylurea |
|---|---|
| PubChem CID | 58469260 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 1-(2,4-dimethylpentan-3-yl)-1,3,3-trimethylurea |
| SMILES | CC(C)C(C(C)C)N(C)C(=O)N(C)C |
| InChI | InChI=1S/C11H24N2O/c1-8(2)10(9(3)4)13(7)11(14)12(5)6/h8-10H,1-7H3 |
| InChIKey | PBTJMSALLZKKQS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |