C55H41N3 — CID 58470938
N-phenyl-N-[(1E,3E)-4-[4-[4-[4-[4-(1-phenylbenzimidazol-2-yl)phenyl]phenyl]phenyl]phenyl]hexa-1,3,5-trienyl]aniline (PubChem CID 58470938) has the molecular formula C55H41N3 and a molecular weight of 743.95 g/mol. Its IUPAC name is N-phenyl-N-[(1E,3E)-4-[4-[4-[4-[4-(1-phenylbenzimidazol-2-yl)phenyl]phenyl]phenyl]phenyl]hexa-1,3,5-trienyl]aniline.
| Compound Name | N-phenyl-N-[(1E,3E)-4-[4-[4-[4-[4-(1-phenylbenzimidazol-2-yl)phenyl]phenyl]phenyl]phenyl]hexa-1,3,5-trienyl]aniline |
|---|---|
| PubChem CID | 58470938 |
| Molecular Formula | C55H41N3 |
| Molecular Weight | 743.95 g/mol |
| Exact Mass | 743.33 |
| IUPAC Name | N-phenyl-N-[(1E,3E)-4-[4-[4-[4-[4-(1-phenylbenzimidazol-2-yl)phenyl]phenyl]phenyl]phenyl]hexa-1,3,5-trienyl]aniline |
| SMILES | C=C/C(=C\C=C\N(c1ccccc1)c1ccccc1)c1ccc(-c2ccc(-c3ccc(-c4ccc(-c5nc6ccccc6n5-c5ccccc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C55H41N3/c1-2-41(15-14-40-57(50-16-6-3-7-17-50)51-18-8-4-9-19-51)42-24-26-43(27-25-42)44-28-30-45(31-29-44)46-32-34-47(35-33-46)48-36-38-49(39-37-48)55-56-53-22-12-13-23-54(53)58(55)52-20-10-5-11-21-52/h2-40H,1H2/b40-14+,41-15+ |
| InChIKey | PRDVXIHHJKEXCD-AIQTUGPHSA-N |
| XLogP | 14.61 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.95 |
| LogP ≤ 5 | 14.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|