C20H21FN4O2 — CID 58473081
4-[4-(4-fluorophenyl)-5-[2-(hydroxymethyl)pyrimidin-4-yl]imidazol-1-yl]cyclohexan-1-ol (PubChem CID 58473081) has the molecular formula C20H21FN4O2 and a molecular weight of 368.41 g/mol. Its IUPAC name is 4-[4-(4-fluorophenyl)-5-[2-(hydroxymethyl)pyrimidin-4-yl]imidazol-1-yl]cyclohexan-1-ol.
| Compound Name | 4-[4-(4-fluorophenyl)-5-[2-(hydroxymethyl)pyrimidin-4-yl]imidazol-1-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 58473081 |
| Molecular Formula | C20H21FN4O2 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 4-[4-(4-fluorophenyl)-5-[2-(hydroxymethyl)pyrimidin-4-yl]imidazol-1-yl]cyclohexan-1-ol |
| SMILES | OCc1nccc(-c2c(-c3ccc(F)cc3)ncn2C2CCC(O)CC2)n1 |
| InChI | InChI=1S/C20H21FN4O2/c21-14-3-1-13(2-4-14)19-20(17-9-10-22-18(11-26)24-17)25(12-23-19)15-5-7-16(27)8-6-15/h1-4,9-10,12,15-16,26-27H,5-8,11H2 |
| InChIKey | YQZAJGQPRSJARM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |